CAS 946713-86-6

2-(4-fluoro-3-methoxy-phenyl)acetic acid

Description:

2-(4-Fluoro-3-methoxy-phenyl)acetic acid is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with a fluorine atom and a methoxy group, contributing to its unique chemical properties. The presence of the acetic acid moiety indicates that it has acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the aromatic ring may enhance its lipophilicity. The fluorine atom can influence the compound's reactivity and biological activity, often enhancing metabolic stability and altering pharmacokinetic properties. Additionally, the methoxy group can affect the electronic distribution within the molecule, potentially impacting its interactions with biological targets. Overall, 2-(4-fluoro-3-methoxy-phenyl)acetic acid is of interest in medicinal chemistry and may have applications in drug development or as a biochemical probe.

Formula: C₉H₉FO₃

InChI: InChI=1/C9H9FO3/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4H,5H2,1H3,(H,11,12)

SMILES: COc1cc(ccc1F)CC(=O)O

Synonyms:

• (4-Fluoro-3-methoxyphenyl)acetic acid
• Benzeneacetic Acid, 4-Fluoro-3-Methoxy-
• 4-Fluoro-3-methoxyphenylaceticacid
• 4-Fluoro-3-methoxyphenylacetic acid

Benzeneacetic acid, 4-fluoro-3-methoxy-

CAS: 946713-86-6

Formula: C₉H₉FO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 184.1644

Ref: IN-DA00IIFP

4-Fluoro-3-methoxyphenylacetic acid

CAS: 946713-86-6

4-Fluoro-3-methoxyphenylacetic acid

Purity: 97%

Molecular weight: 184.16g/mol

Ref: 54-PC6976

2-(4-Fluoro-3-methoxyphenyl)acetic acid

CAS: 946713-86-6

Formula: C₉H₉FO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 184.166

Ref: 10-F078046