
CAS 946714-22-3
:4-Fluoro-2′-methyl[1,1′-biphenyl]-3-methanamine
Description:
4-Fluoro-2′-methyl[1,1′-biphenyl]-3-methanamine, identified by its CAS number 946714-22-3, is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 4-position and a methyl group at the 2′-position of the biphenyl framework contributes to its unique chemical properties. Additionally, the methanamine functional group at the 3-position introduces basicity and potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the surrounding environment, such as pH and solvent polarity. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 4-Fluoro-2′-methyl[1,1′-biphenyl]-3-methanamine represents a complex structure with diverse applications in research and industry.
Formula:C14H14FN
InChI:InChI=1S/C14H14FN/c1-10-4-2-3-5-13(10)11-6-7-14(15)12(8-11)9-16/h2-8H,9,16H2,1H3
InChI key:InChIKey=GTTIRCQIXAFVJJ-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1)C2=CC(CN)=C(F)C=C2
Synonyms:- [1,1′-Biphenyl]-3-methanamine, 4-fluoro-2′-methyl-
- 4-Fluoro-2′-methyl[1,1′-biphenyl]-3-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.