CAS 946714-38-1

2-(3-Chloro-4-fluorophenoxy)benzenamine

Description:

2-(3-Chloro-4-fluorophenoxy)benzenamine, identified by its CAS number 946714-38-1, is an organic compound characterized by its aromatic structure, which includes a phenoxy group and an aniline moiety. This compound features a chloro and a fluoro substituent on the phenyl ring, contributing to its unique chemical properties. The presence of these halogen atoms can influence the compound's reactivity, solubility, and potential biological activity. Typically, compounds like this may exhibit properties such as moderate to high lipophilicity due to their aromatic nature, which can affect their interaction with biological systems. Additionally, the presence of the amino group suggests potential for hydrogen bonding, which can influence solubility in polar solvents. This compound may be of interest in pharmaceutical research or material science due to its structural characteristics, which could lead to specific applications in drug development or as a building block in organic synthesis. However, detailed studies would be necessary to fully understand its reactivity and potential uses.

Formula: C₁₂H₉ClFNO

InChI: InChI=1S/C12H9ClFNO/c13-9-7-8(5-6-10(9)14)16-12-4-2-1-3-11(12)15/h1-7H,15H2

InChI key: InChIKey=RRALWLOWECKQMC-UHFFFAOYSA-N

SMILES: O(C1=CC(Cl)=C(F)C=C1)C2=C(N)C=CC=C2

Synonyms:

• 2-(3-Chloro-4-fluorophenoxy)benzenamine
• 2-(3-Chloro-4-fluorophenoxy)aniline
• Benzenamine, 2-(3-chloro-4-fluorophenoxy)-