
CAS 946714-41-6
:3-[3-(1-Methylethyl)phenoxy]piperidine
Description:
3-[3-(1-Methylethyl)phenoxy]piperidine, identified by its CAS number 946714-41-6, is a chemical compound that features a piperidine ring substituted with a phenoxy group. The presence of the isopropyl group (1-methylethyl) on the phenyl ring contributes to its hydrophobic characteristics, which can influence its solubility and interaction with biological systems. This compound is typically characterized by its molecular structure, which includes a piperidine moiety—a six-membered ring containing one nitrogen atom—and a phenoxy group, which is an aromatic ring bonded to an oxygen atom. The compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions under which they are measured. Additionally, the compound's potential applications could range from medicinal chemistry to agrochemicals, depending on its biological activity and interaction with specific targets.
Formula:C14H21NO
InChI:InChI=1S/C14H21NO/c1-11(2)12-5-3-6-13(9-12)16-14-7-4-8-15-10-14/h3,5-6,9,11,14-15H,4,7-8,10H2,1-2H3
InChI key:InChIKey=BHBWHZTTYBNONX-UHFFFAOYSA-N
SMILES:O(C1=CC(C(C)C)=CC=C1)C2CCCNC2
Synonyms:- 3-[3-(1-Methylethyl)phenoxy]piperidine
- Piperidine, 3-[3-(1-methylethyl)phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.