CAS 946714-42-7

2-[4-(Phenylmethyl)phenoxy]benzenamine

Description:

2-[4-(Phenylmethyl)phenoxy]benzenamine, identified by its CAS number 946714-42-7, is an organic compound characterized by its complex aromatic structure. It features a central benzenamine moiety, which is an amine derivative of benzene, indicating the presence of an amino group (-NH2) attached to a benzene ring. The compound also contains a phenoxy group, where a phenyl ring is bonded to an oxygen atom, and a phenylmethyl substituent, which adds to its aromatic character. This structure suggests potential applications in pharmaceuticals or as a chemical intermediate due to its ability to engage in various chemical reactions, such as electrophilic substitutions. The presence of multiple aromatic rings may contribute to its stability and influence its solubility and reactivity. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 2-[4-(Phenylmethyl)phenoxy]benzenamine is a notable compound in organic chemistry with potential implications in various fields.

Formula: C₁₉H₁₇NO

InChI: InChI=1S/C19H17NO/c20-18-8-4-5-9-19(18)21-17-12-10-16(11-13-17)14-15-6-2-1-3-7-15/h1-13H,14,20H2

InChI key: InChIKey=QMIQLBUKBOXKNI-UHFFFAOYSA-N

SMILES: O(C1=C(N)C=CC=C1)C2=CC=C(CC3=CC=CC=C3)C=C2

Synonyms:

• Benzenamine, 2-[4-(phenylmethyl)phenoxy]-
• 2-[4-(Phenylmethyl)phenoxy]benzenamine