
CAS 946714-45-0
:2-(3-Ethoxyphenoxy)benzenamine
Description:
2-(3-Ethoxyphenoxy)benzenamine, identified by its CAS number 946714-45-0, is an organic compound characterized by its aromatic structure, which includes both an amine and ether functional group. This compound features a central benzene ring substituted with an amine group (–NH2) and an ether moiety (–O–) linked to a 3-ethoxyphenyl group. The presence of the ethoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of substituents. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. As with any chemical substance, safety data and handling precautions should be reviewed before use.
Formula:C14H15NO2
InChI:InChI=1S/C14H15NO2/c1-2-16-11-6-5-7-12(10-11)17-14-9-4-3-8-13(14)15/h3-10H,2,15H2,1H3
InChI key:InChIKey=HXVQNBXIXLQZCD-UHFFFAOYSA-N
SMILES:O(C1=CC(OCC)=CC=C1)C2=C(N)C=CC=C2
Synonyms:- 2-(3-Ethoxyphenoxy)benzenamine
- Benzenamine, 2-(3-ethoxyphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.