CAS 946714-54-1

3-Chloro-2-(1-naphthalenylmethoxy)benzenamine

Description:

3-Chloro-2-(1-naphthalenylmethoxy)benzenamine, with the CAS number 946714-54-1, is an organic compound characterized by its complex structure, which includes a chloro substituent, an amine group, and a naphthalenylmethoxy moiety. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine group. The chloro substituent can influence the compound's electronic properties and reactivity, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions. The naphthalene ring contributes to the compound's hydrophobic character and may enhance its interactions with biological systems, suggesting potential applications in pharmaceuticals or materials science. Additionally, the presence of multiple functional groups may allow for further derivatization, making it a versatile building block in organic synthesis. Safety considerations should be taken into account, as compounds with amine and chloro groups can pose health risks and require appropriate handling and disposal measures.

Formula: C₁₇H₁₄ClNO

InChI: InChI=1S/C17H14ClNO/c18-15-9-4-10-16(19)17(15)20-11-13-7-3-6-12-5-1-2-8-14(12)13/h1-10H,11,19H2

InChI key: InChIKey=OSQURHYMKYBGMA-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)C=CC=C1N)C=2C3=C(C=CC2)C=CC=C3

Synonyms:

• Benzenamine, 3-chloro-2-(1-naphthalenylmethoxy)-
• 3-Chloro-2-(1-naphthalenylmethoxy)benzenamine