CAS 946714-65-4

3-(3-Ethoxyphenoxy)piperidine

Description:

3-(3-Ethoxyphenoxy)piperidine, identified by its CAS number 946714-65-4, is a chemical compound that features a piperidine ring substituted with a 3-ethoxyphenoxy group. This structure suggests that it possesses both aromatic and aliphatic characteristics, which can influence its solubility and reactivity. The presence of the ethoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with various biological targets. The compound may exhibit properties typical of piperidine derivatives, such as acting as a ligand for neurotransmitter receptors or other biological pathways. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including purification methods like chromatography. Safety and handling considerations are essential, as with any chemical substance, to mitigate risks associated with exposure. Overall, 3-(3-Ethoxyphenoxy)piperidine represents a compound of interest in both research and potential therapeutic applications.

Formula: C₁₃H₁₉NO₂

InChI: InChI=1S/C13H19NO2/c1-2-15-11-5-3-6-12(9-11)16-13-7-4-8-14-10-13/h3,5-6,9,13-14H,2,4,7-8,10H2,1H3

InChI key: InChIKey=PKJKVQXZRWUYRM-UHFFFAOYSA-N

SMILES: O(C1=CC(OCC)=CC=C1)C2CCCNC2

Synonyms:

• Piperidine, 3-(3-ethoxyphenoxy)-
• 3-(3-Ethoxyphenoxy)piperidine