CAS 946715-02-2

N-[2-(2-Amino-4-chlorophenoxy)ethyl]-N-methylbenzenamine

Description:

N-[2-(2-Amino-4-chlorophenoxy)ethyl]-N-methylbenzenamine, identified by its CAS number 946715-02-2, is an organic compound characterized by its complex structure, which includes an amine functional group and a chlorophenoxy moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the chlorophenyl group may impart specific electronic and steric effects, potentially affecting its reactivity and interactions with biological systems. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals or as a chemical intermediate, particularly in the synthesis of more complex molecules. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other reactive species. As with many organic compounds, safety data and handling precautions should be considered, especially due to the presence of chlorine and amine functionalities, which can pose health risks.

Formula: C₁₅H₁₇ClN₂O

InChI: InChI=1S/C15H17ClN2O/c1-18(13-5-3-2-4-6-13)9-10-19-15-8-7-12(16)11-14(15)17/h2-8,11H,9-10,17H2,1H3

InChI key: InChIKey=BWZWPJOZXFDPBX-UHFFFAOYSA-N

SMILES: O(CCN(C)C1=CC=CC=C1)C2=C(N)C=C(Cl)C=C2

Synonyms:

• Benzenamine, N-[2-(2-amino-4-chlorophenoxy)ethyl]-N-methyl-
• N-[2-(2-Amino-4-chlorophenoxy)ethyl]-N-methylbenzenamine