CymitQuimica logo

CAS 946715-06-6

:

5-Chloro-2-(2-chloro-5-methylphenoxy)benzenamine

Description:
5-Chloro-2-(2-chloro-5-methylphenoxy)benzenamine, with the CAS number 946715-06-6, is an organic compound characterized by its complex aromatic structure. It features a primary amine group (-NH2) attached to a benzene ring, which is further substituted with chlorine and phenoxy groups. The presence of chlorine atoms enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical and agrochemical research. The compound's molecular structure suggests potential applications in the synthesis of various derivatives, which could exhibit specific properties based on the substituents' positions and nature. Additionally, the presence of the phenoxy group may impart unique solubility characteristics and interactions with biological systems. As with many chlorinated compounds, considerations regarding environmental impact and toxicity are essential, particularly in terms of persistence and bioaccumulation. Overall, 5-Chloro-2-(2-chloro-5-methylphenoxy)benzenamine represents a compound with significant potential for further study in various chemical and biological contexts.
Formula:C13H11Cl2NO
InChI:InChI=1S/C13H11Cl2NO/c1-8-2-4-10(15)13(6-8)17-12-5-3-9(14)7-11(12)16/h2-7H,16H2,1H3
InChI key:InChIKey=QZPSQIXOVJCWFK-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=CC(C)=C1)C2=C(N)C=C(Cl)C=C2
Synonyms:
  • 5-Chloro-2-(2-chloro-5-methylphenoxy)benzenamine
  • Benzenamine, 5-chloro-2-(2-chloro-5-methylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.