
CAS 946715-14-6
:5-Chloro-2-(3-chloro-4-fluorophenoxy)benzenamine
Description:
5-Chloro-2-(3-chloro-4-fluorophenoxy)benzenamine is an organic compound characterized by its complex structure, which includes a benzene ring substituted with both amino and chloro groups, as well as a phenoxy group that contains a fluorine atom. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The chloro and fluorine substituents can influence its electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of halogens may impart unique biological activities, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may participate in hydrogen bonding, affecting its physical properties like melting and boiling points. Safety considerations are important, as many chlorinated and fluorinated compounds can pose environmental and health risks. Overall, 5-Chloro-2-(3-chloro-4-fluorophenoxy)benzenamine is a compound of interest in both synthetic chemistry and medicinal applications.
Formula:C12H8Cl2FNO
InChI:InChI=1S/C12H8Cl2FNO/c13-7-1-4-12(11(16)5-7)17-8-2-3-10(15)9(14)6-8/h1-6H,16H2
InChI key:InChIKey=PQRUUJCAYKJBBM-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(Cl)C=C1)C2=CC(Cl)=C(F)C=C2
Synonyms:- Benzenamine, 5-chloro-2-(3-chloro-4-fluorophenoxy)-
- 5-Chloro-2-(3-chloro-4-fluorophenoxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.