CymitQuimica logo

CAS 946715-26-0

:

5-Chloro-2-(3-ethoxyphenoxy)benzenamine

Description:
5-Chloro-2-(3-ethoxyphenoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a chloro substituent and an amine functional group. The presence of the chloro group indicates that it is likely to exhibit reactivity typical of halogenated compounds, such as participating in nucleophilic substitution reactions. The ethoxyphenoxy moiety suggests that the compound has both ether and phenolic characteristics, which can influence its solubility and reactivity. This compound may be used in various applications, including pharmaceuticals or agrochemicals, due to its potential biological activity. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of both electron-donating (ethoxy) and electron-withdrawing (chloro) groups can affect the electronic properties of the molecule, influencing its reactivity and stability. Overall, 5-Chloro-2-(3-ethoxyphenoxy)benzenamine is a complex molecule with diverse potential applications in chemical research and industry.
Formula:C14H14ClNO2
InChI:InChI=1S/C14H14ClNO2/c1-2-17-11-4-3-5-12(9-11)18-14-7-6-10(15)8-13(14)16/h3-9H,2,16H2,1H3
InChI key:InChIKey=LBZVQSUKYRUBHH-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(Cl)C=C1)C2=CC(OCC)=CC=C2
Synonyms:
  • 5-Chloro-2-(3-ethoxyphenoxy)benzenamine
  • Benzenamine, 5-chloro-2-(3-ethoxyphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.