
CAS 946715-33-9
:2-(1-Naphthalenylmethoxy)-5-(trifluoromethyl)benzenamine
Description:
2-(1-Naphthalenylmethoxy)-5-(trifluoromethyl)benzenamine, identified by its CAS number 946715-33-9, is an organic compound characterized by its complex structure, which includes a naphthalene moiety and a trifluoromethyl group. This compound features a benzenamine core, where the amino group (-NH2) is substituted at the 5-position with a trifluoromethyl group (-CF3) and at the 2-position with a methoxy group linked to a naphthalene ring. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The naphthalene component contributes to its aromatic character and potential electronic properties. This compound may exhibit unique reactivity and interactions due to its functional groups, making it a candidate for various applications in pharmaceuticals or materials science. Its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopy and chromatography for purity assessment.
Formula:C18H14F3NO
InChI:InChI=1S/C18H14F3NO/c19-18(20,21)14-8-9-17(16(22)10-14)23-11-13-6-3-5-12-4-1-2-7-15(12)13/h1-10H,11,22H2
InChI key:InChIKey=PVQHOITUTHDXSK-UHFFFAOYSA-N
SMILES:C(OC1=C(N)C=C(C(F)(F)F)C=C1)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- 2-(1-Naphthalenylmethoxy)-5-(trifluoromethyl)benzenamine
- Benzenamine, 2-(1-naphthalenylmethoxy)-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.