CymitQuimica logo

CAS 946715-42-0

:

2-[2-Methyl-5-(1-methylethyl)phenoxy]-5-(trifluoromethyl)benzenamine

Description:
2-[2-Methyl-5-(1-methylethyl)phenoxy]-5-(trifluoromethyl)benzenamine, identified by its CAS number 946715-42-0, is a chemical compound characterized by its complex aromatic structure. It features a phenoxy group, which is a phenyl ether, linked to a substituted aniline. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in various applications, including pharmaceuticals and agrochemicals. The compound also contains a branched alkyl substituent, which can affect its solubility and interaction with biological systems. Its molecular structure suggests potential for specific interactions with biological targets, possibly leading to unique pharmacological properties. Additionally, the trifluoromethyl group is known for its electron-withdrawing effects, which can modify the reactivity and stability of the compound. Overall, this substance exemplifies the complexity and diversity of organic compounds, particularly in the context of drug design and development.
Formula:C17H18F3NO
InChI:InChI=1S/C17H18F3NO/c1-10(2)12-5-4-11(3)16(8-12)22-15-7-6-13(9-14(15)21)17(18,19)20/h4-10H,21H2,1-3H3
InChI key:InChIKey=SULHXLRHLNJDSR-UHFFFAOYSA-N
SMILES:O(C1=CC(C(C)C)=CC=C1C)C2=C(N)C=C(C(F)(F)F)C=C2
Synonyms:
  • Benzenamine, 2-[2-methyl-5-(1-methylethyl)phenoxy]-5-(trifluoromethyl)-
  • 2-[2-Methyl-5-(1-methylethyl)phenoxy]-5-(trifluoromethyl)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.