CAS 946715-48-6

2-(3,5-Dimethylphenoxy)-5-(trifluoromethyl)benzenamine

Description:

2-(3,5-Dimethylphenoxy)-5-(trifluoromethyl)benzenamine, identified by its CAS number 946715-48-6, is an organic compound characterized by its complex aromatic structure. This substance features a phenoxy group, which is a phenyl ring bonded to an oxygen atom, and a trifluoromethyl group, which enhances its chemical reactivity and lipophilicity. The presence of the dimethyl substituents on the phenyl ring contributes to its steric properties and may influence its biological activity. This compound is likely to exhibit properties typical of aromatic amines, such as potential basicity due to the amine functional group. Additionally, the trifluoromethyl group can impart unique electronic characteristics, making it useful in various applications, including pharmaceuticals and agrochemicals. The compound's solubility, stability, and reactivity can be influenced by the arrangement of its substituents, which may also affect its interactions in biological systems. Overall, this compound represents a class of chemicals with potential utility in diverse fields, including medicinal chemistry and materials science.

Formula: C₁₅H₁₄F₃NO

InChI: InChI=1S/C15H14F3NO/c1-9-5-10(2)7-12(6-9)20-14-4-3-11(8-13(14)19)15(16,17)18/h3-8H,19H2,1-2H3

InChI key: InChIKey=UCXNTABIUVCKNC-UHFFFAOYSA-N

SMILES: O(C1=C(N)C=C(C(F)(F)F)C=C1)C2=CC(C)=CC(C)=C2

Synonyms:

• Benzenamine, 2-(3,5-dimethylphenoxy)-5-(trifluoromethyl)-
• 2-(3,5-Dimethylphenoxy)-5-(trifluoromethyl)benzenamine