CAS 946715-63-5

2-(2-Furanylmethoxy)-5-methylbenzenamine

Description:

2-(2-Furanylmethoxy)-5-methylbenzenamine, identified by its CAS number 946715-63-5, is an organic compound characterized by its unique molecular structure, which includes a furan ring and an amine group. This compound features a methoxy linkage connecting the furan moiety to a substituted aniline, specifically a 5-methyl group on the benzene ring. The presence of the furan ring imparts certain aromatic properties, while the amine group can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and material science. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Additionally, its synthesis may involve standard organic reactions, including substitution and coupling reactions, which are common in the preparation of substituted anilines and related compounds. Overall, 2-(2-Furanylmethoxy)-5-methylbenzenamine represents a versatile structure with potential applications in various chemical fields.

Formula: C₁₂H₁₃NO₂

InChI: InChI=1S/C12H13NO2/c1-9-4-5-12(11(13)7-9)15-8-10-3-2-6-14-10/h2-7H,8,13H2,1H3

InChI key: InChIKey=LISSTFLQWATCQC-UHFFFAOYSA-N

SMILES: O(CC1=CC=CO1)C2=C(N)C=C(C)C=C2

Synonyms:

• Benzenamine, 2-(2-furanylmethoxy)-5-methyl-
• 2-(2-Furanylmethoxy)-5-methylbenzenamine