CAS 946715-71-5

3-(4-Bromo-2-methylphenoxy)pyrrolidine

Description:

3-(4-Bromo-2-methylphenoxy)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a phenoxy group substituted with a bromine atom and a methyl group. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic phenoxy moiety, which may affect its solubility and permeability in biological systems. Additionally, the pyrrolidine ring contributes to its potential as a scaffold for drug development, as it can participate in various interactions with biological targets. The compound's molecular weight, boiling point, and melting point are influenced by its specific functional groups and overall structure. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the bromine atom, which can pose health risks. Overall, 3-(4-Bromo-2-methylphenoxy)pyrrolidine represents a compound of interest for further research in pharmacology and organic synthesis.

Formula: C₁₁H₁₄BrNO

InChI: InChI=1S/C11H14BrNO/c1-8-6-9(12)2-3-11(8)14-10-4-5-13-7-10/h2-3,6,10,13H,4-5,7H2,1H3

InChI key: InChIKey=AXFHOYQZERTNHG-UHFFFAOYSA-N

SMILES: O(C1=C(C)C=C(Br)C=C1)C2CCNC2

Synonyms:

• Pyrrolidine, 3-(4-bromo-2-methylphenoxy)-
• 3-(4-Bromo-2-methylphenoxy)pyrrolidine