
CAS 946715-84-0
:2-(3-Methoxyphenoxy)-5-methylbenzenamine
Description:
2-(3-Methoxyphenoxy)-5-methylbenzenamine, with the CAS number 946715-84-0, is an organic compound characterized by its aromatic structure, which includes a methoxy group and an amine functional group. This compound features a biphenyl structure, where one of the phenyl rings is substituted with a methoxy group (-OCH₃) at the 3-position, and the other ring contains an amine group (-NH₂) at the 5-position. The presence of these functional groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. The methoxy group can enhance the compound's solubility and influence its reactivity, while the amine group may participate in hydrogen bonding and other interactions. Additionally, the compound's molecular structure may exhibit specific physical properties such as melting and boiling points, solubility in various solvents, and stability under different conditions. Overall, the unique combination of functional groups in 2-(3-Methoxyphenoxy)-5-methylbenzenamine contributes to its potential utility in various chemical applications.
Formula:C14H15NO2
InChI:InChI=1S/C14H15NO2/c1-10-6-7-14(13(15)8-10)17-12-5-3-4-11(9-12)16-2/h3-9H,15H2,1-2H3
InChI key:InChIKey=QFFKBDRKAXGJQN-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(C)C=C1)C2=CC(OC)=CC=C2
Synonyms:- 2-(3-Methoxyphenoxy)-5-methylbenzenamine
- Benzenamine, 2-(3-methoxyphenoxy)-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.