
CAS 946715-87-3
:5-Methyl-2-(3-methylphenoxy)benzenamine
Description:
5-Methyl-2-(3-methylphenoxy)benzenamine, with the CAS number 946715-87-3, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with both a methyl group and a 3-methylphenoxy group, which contributes to its unique chemical properties. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while its amine functional group may impart some degree of polarity. The presence of multiple methyl groups can influence its steric hindrance and reactivity, potentially affecting its interactions in chemical reactions or biological systems. As an aromatic amine, it may also participate in electrophilic substitution reactions and can be a precursor for various chemical syntheses. Safety considerations should be taken into account, as many aromatic amines can be toxic or carcinogenic. Overall, 5-Methyl-2-(3-methylphenoxy)benzenamine is a compound of interest in organic chemistry and may have applications in pharmaceuticals or materials science.
Formula:C14H15NO
InChI:InChI=1S/C14H15NO/c1-10-4-3-5-12(8-10)16-14-7-6-11(2)9-13(14)15/h3-9H,15H2,1-2H3
InChI key:InChIKey=ZGKOXWCOVBVUGO-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(C)C=C1)C2=CC(C)=CC=C2
Synonyms:- 5-Methyl-2-(3-methylphenoxy)benzenamine
- Benzenamine, 5-methyl-2-(3-methylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.