CymitQuimica logo

CAS 946716-30-9

:

2-(2-Chloro-5-methylphenoxy)-4-methylbenzenamine

Description:
2-(2-Chloro-5-methylphenoxy)-4-methylbenzenamine, with the CAS number 946716-30-9, is an organic compound characterized by its aromatic structure, which includes a chloro-substituted phenyl group and an amine functional group. This compound features a phenoxy linkage, connecting a 2-chloro-5-methylphenyl moiety to a 4-methylbenzenamine. The presence of chlorine and methyl groups contributes to its unique reactivity and physical properties, such as solubility and boiling point. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research or agrochemical applications. The amine group can participate in hydrogen bonding, influencing its interactions in various chemical environments. Additionally, the compound's stability and reactivity can be affected by the electron-donating and withdrawing effects of the substituents on the aromatic rings. Overall, this compound represents a specific class of substituted anilines with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C14H14ClNO
InChI:InChI=1S/C14H14ClNO/c1-9-3-5-11(15)13(7-9)17-14-8-10(2)4-6-12(14)16/h3-8H,16H2,1-2H3
InChI key:InChIKey=HOAWVZLDZZSMOM-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=CC(C)=C1)C2=C(N)C=CC(C)=C2
Synonyms:
  • Benzenamine, 2-(2-chloro-5-methylphenoxy)-4-methyl-
  • 2-(2-Chloro-5-methylphenoxy)-4-methylbenzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.