CymitQuimica logo

CAS 946716-42-3

:

3-(2-Amino-5-methylphenoxy)-N,N-dimethylbenzenamine

Description:
3-(2-Amino-5-methylphenoxy)-N,N-dimethylbenzenamine, identified by its CAS number 946716-42-3, is an organic compound characterized by its complex structure, which includes an amino group, a phenoxy group, and a dimethylamino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the methyl groups may enhance its lipophilicity, potentially affecting its biological activity and interaction with cellular membranes. Additionally, the compound's aromatic rings contribute to its stability and may allow for π-π stacking interactions. Its specific applications can vary, but compounds of this nature are often explored in medicinal chemistry for their potential as pharmaceuticals or as intermediates in the synthesis of more complex molecules. Safety and handling considerations are essential, as with many amines, due to their potential reactivity and toxicity.
Formula:C15H18N2O
InChI:InChI=1S/C15H18N2O/c1-11-7-8-14(16)15(9-11)18-13-6-4-5-12(10-13)17(2)3/h4-10H,16H2,1-3H3
InChI key:InChIKey=NEHKOTJSDIGMDN-UHFFFAOYSA-N
SMILES:O(C1=CC(N(C)C)=CC=C1)C2=C(N)C=CC(C)=C2
Synonyms:
  • Benzenamine, 3-(2-amino-5-methylphenoxy)-N,N-dimethyl-
  • 3-(2-Amino-5-methylphenoxy)-N,N-dimethylbenzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.