
CAS 946725-22-0
:1-(2-Aminoethyl)-1,2-dihydro-3,6-pyridazinedione
Description:
1-(2-Aminoethyl)-1,2-dihydro-3,6-pyridazinedione, identified by its CAS number 946725-22-0, is a chemical compound characterized by its unique structure, which includes a pyridazine ring with amino and carbonyl functional groups. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of the amino group, which can participate in various chemical reactions and interactions. The dihydropyridazine moiety suggests that it may have reduced reactivity compared to fully aromatic systems, potentially influencing its stability and solubility in different solvents. Additionally, the presence of the aminoethyl side chain may enhance its ability to form hydrogen bonds, impacting its interactions with biological targets. While specific physical properties like melting point, boiling point, and solubility are not detailed here, compounds of this nature often find applications in medicinal chemistry and drug development due to their structural diversity and potential pharmacological effects. Further studies would be necessary to fully elucidate its characteristics and applications.
Formula:C6H9N3O2
InChI:InChI=1S/C6H9N3O2/c7-3-4-9-6(11)2-1-5(10)8-9/h1-2H,3-4,7H2,(H,8,10)
InChI key:InChIKey=KCIFZAWTIOZTBL-UHFFFAOYSA-N
SMILES:C(CN)N1C(=O)C=CC(=O)N1
Synonyms:- 3,6-Pyridazinedione, 1-(2-aminoethyl)-1,2-dihydro-
- 1-(2-Aminoethyl)-1,2,3,6-tetrahydropyridazine-3,6-dione
- 1-(2-Aminoethyl)-1,2-dihydro-3,6-pyridazinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.