
CAS 946726-03-0
:3-[4-(1-Methylethyl)phenoxy]piperidine
Description:
3-[4-(1-Methylethyl)phenoxy]piperidine, identified by its CAS number 946726-03-0, is a chemical compound that features a piperidine ring substituted with a phenoxy group. The structure includes an isopropyl group attached to the para position of the phenyl ring, which contributes to its hydrophobic characteristics. This compound is typically characterized by its moderate polarity, making it soluble in organic solvents while having limited solubility in water. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. Additionally, the compound may exhibit specific interactions with biological targets due to its structural features, which can influence its reactivity and stability. Overall, 3-[4-(1-Methylethyl)phenoxy]piperidine is of interest in medicinal chemistry and may serve as a lead compound for further development in therapeutic applications.
Formula:C14H21NO
InChI:InChI=1S/C14H21NO/c1-11(2)12-5-7-13(8-6-12)16-14-4-3-9-15-10-14/h5-8,11,14-15H,3-4,9-10H2,1-2H3
InChI key:InChIKey=DYLBQZLBKYGVOJ-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C(C)C)C=C1)C2CCCNC2
Synonyms:- 3-[4-(1-Methylethyl)phenoxy]piperidine
- Piperidine, 3-[4-(1-methylethyl)phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.