
CAS 946726-06-3
:3-(4-Ethylphenoxy)piperidine
Description:
3-(4-Ethylphenoxy)piperidine is an organic compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a 4-ethylphenoxy group indicates that there is an ethyl-substituted phenyl group attached via an ether linkage to the piperidine nitrogen. This structure contributes to its potential lipophilicity and ability to interact with biological systems. The compound may exhibit properties typical of piperidine derivatives, such as being a potential ligand for various receptors or enzymes. Its molecular structure suggests it could be involved in medicinal chemistry, possibly as a lead compound in drug development. The compound's CAS number, 946726-06-3, allows for precise identification in chemical databases. As with many organic compounds, its solubility, stability, and reactivity will depend on environmental conditions such as pH and temperature. Overall, 3-(4-Ethylphenoxy)piperidine is of interest in research contexts, particularly in pharmacology and organic synthesis.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-2-11-5-7-12(8-6-11)15-13-4-3-9-14-10-13/h5-8,13-14H,2-4,9-10H2,1H3
InChI key:InChIKey=ZGTUBYNKHIHLET-UHFFFAOYSA-N
SMILES:O(C1=CC=C(CC)C=C1)C2CCCNC2
Synonyms:- Piperidine, 3-(4-ethylphenoxy)-
- 3-(4-Ethylphenoxy)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.