CymitQuimica logo

CAS 946726-09-6

:

3-(2-Naphthalenyloxy)piperidine

Description:
3-(2-Naphthalenyloxy)piperidine, identified by its CAS number 946726-09-6, is a chemical compound characterized by its unique structure, which features a piperidine ring substituted with a 2-naphthyloxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the naphthalene moiety may impart hydrophobic characteristics, influencing its solubility and interaction with biological membranes. Additionally, the piperidine ring can participate in hydrogen bonding and may serve as a basic site due to the nitrogen atom. Such structural features suggest that 3-(2-Naphthalenyloxy)piperidine could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, and its reactivity may be explored in the context of drug design or as a potential ligand in coordination chemistry. Overall, this compound represents a fascinating intersection of organic chemistry and pharmacology.
Formula:C15H17NO
InChI:InChI=1S/C15H17NO/c1-2-5-13-10-14(8-7-12(13)4-1)17-15-6-3-9-16-11-15/h1-2,4-5,7-8,10,15-16H,3,6,9,11H2
InChI key:InChIKey=AFAHCPYVSZXOAZ-UHFFFAOYSA-N
SMILES:O(C1=CC2=C(C=C1)C=CC=C2)C3CCCNC3
Synonyms:
  • Piperidine, 3-(2-naphthalenyloxy)-
  • 3-(2-Naphthalenyloxy)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.