CAS 946726-18-7
:3-(2,5-Difluorophenoxy)piperidine
Description:
3-(2,5-Difluorophenoxy)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The compound features a phenoxy group, specifically a 2,5-difluorophenyl moiety, indicating the presence of two fluorine atoms substituted on the phenyl ring at the 2 and 5 positions. This substitution can influence the compound's electronic properties and reactivity. The presence of the piperidine ring contributes to its potential as a pharmacophore in medicinal chemistry, often associated with various biological activities. The compound's molecular structure suggests it may exhibit lipophilicity, which can affect its solubility and permeability in biological systems. Additionally, the fluorine atoms can enhance metabolic stability and influence binding interactions with biological targets. Overall, 3-(2,5-Difluorophenoxy)piperidine is of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals, due to its unique structural features and potential applications.
Formula:C11H13F2NO
InChI:InChI=1S/C11H13F2NO/c12-8-3-4-10(13)11(6-8)15-9-2-1-5-14-7-9/h3-4,6,9,14H,1-2,5,7H2
InChI key:InChIKey=AQHMDFZAJALSII-UHFFFAOYSA-N
SMILES:O(C1=C(F)C=CC(F)=C1)C2CCCNC2
Synonyms:- Piperidine, 3-(2,5-difluorophenoxy)-
- 3-(2,5-Difluorophenoxy)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.