CymitQuimica logo

CAS 946726-21-2

:

3-(4-Chloro-2-fluorophenoxy)piperidine

Description:
3-(4-Chloro-2-fluorophenoxy)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a phenoxy group, specifically a 4-chloro-2-fluorophenyl moiety, indicating the presence of chlorine and fluorine substituents on the aromatic ring. This substitution pattern can influence the compound's electronic properties and reactivity. The presence of the piperidine ring suggests potential applications in medicinal chemistry, as piperidine derivatives are often found in various pharmaceuticals. The compound's molecular structure contributes to its lipophilicity and potential interactions with biological targets. Additionally, the chlorine and fluorine atoms can enhance the compound's stability and bioavailability. Overall, 3-(4-Chloro-2-fluorophenoxy)piperidine is of interest in research and development, particularly in the fields of drug discovery and organic synthesis.
Formula:C11H13ClFNO
InChI:InChI=1S/C11H13ClFNO/c12-8-3-4-11(10(13)6-8)15-9-2-1-5-14-7-9/h3-4,6,9,14H,1-2,5,7H2
InChI key:InChIKey=JFYHSUDQOJUQDD-UHFFFAOYSA-N
SMILES:O(C1=C(F)C=C(Cl)C=C1)C2CCCNC2
Synonyms:
  • Piperidine, 3-(4-chloro-2-fluorophenoxy)-
  • 3-(4-Chloro-2-fluorophenoxy)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.