CAS 946726-30-3

4-(2,5-Dimethylphenoxy)piperidine

Description:

4-(2,5-Dimethylphenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 2,5-dimethylphenoxy group indicates that the compound has a phenolic structure with two methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic nature. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the piperidine moiety is commonly found in various bioactive compounds. The compound's structure suggests it may interact with biological targets, potentially influencing its pharmacological properties. Additionally, the presence of the dimethylphenoxy group may enhance its lipophilicity, affecting its absorption and distribution in biological systems. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₃H₁₉NO

InChI: InChI=1S/C13H19NO/c1-10-3-4-11(2)13(9-10)15-12-5-7-14-8-6-12/h3-4,9,12,14H,5-8H2,1-2H3

InChI key: InChIKey=JKUFYLWACBCYJI-UHFFFAOYSA-N

SMILES: O(C1=C(C)C=CC(C)=C1)C2CCNCC2

Synonyms:

• 4-[(2,5-Dimethylphenyl)oxy]piperidine
• 4-(2,5-Dimethylphenoxy)piperidine
• Piperidine, 4-(2,5-dimethylphenoxy)-