CymitQuimica logo

CAS 946726-33-6

:

4-(3-Iodophenoxy)piperidine

Description:
4-(3-Iodophenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The structure features a phenoxy group substituted with an iodine atom at the para position relative to the ether linkage. This compound is typically classified as an aryl ether and may exhibit properties such as moderate solubility in organic solvents due to the presence of both hydrophobic aromatic and hydrophilic piperidine components. The iodine substituent can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. 4-(3-Iodophenoxy)piperidine may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the design of compounds targeting specific receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, including nucleophilic substitution reactions and purification methods such as chromatography. Safety and handling precautions should be observed due to the presence of iodine, which can be hazardous in certain concentrations.
Formula:C11H14INO
InChI:InChI=1S/C11H14INO/c12-9-2-1-3-11(8-9)14-10-4-6-13-7-5-10/h1-3,8,10,13H,4-7H2
InChI key:InChIKey=ANYHKDGHXMOCAC-UHFFFAOYSA-N
SMILES:O(C1=CC(I)=CC=C1)C2CCNCC2
Synonyms:
  • 4-(3-Iodophenoxy)piperidine
  • Piperidine, 4-(3-iodophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.