CymitQuimica logo

CAS 946726-36-9

:

Piperidine, 4-(4-chloro-3,5-dimethylphenoxy)-

Description:
Piperidine, 4-(4-chloro-3,5-dimethylphenoxy)-, identified by its CAS number 946726-36-9, is a chemical compound that features a piperidine ring substituted with a 4-chloro-3,5-dimethylphenoxy group. This structure imparts specific characteristics to the compound, including its potential as a pharmacological agent or intermediate in organic synthesis. The presence of the piperidine moiety suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. The chlorinated and dimethyl-substituted phenoxy group can influence the compound's solubility, stability, and reactivity, making it of interest in medicinal chemistry. Additionally, the compound may exhibit biological activity, which could be explored in drug development contexts. Overall, the unique combination of functional groups in this compound contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H18ClNO
InChI:InChI=1S/C13H18ClNO/c1-9-7-12(8-10(2)13(9)14)16-11-3-5-15-6-4-11/h7-8,11,15H,3-6H2,1-2H3
InChI key:InChIKey=DLUQDHMNDYCHFE-UHFFFAOYSA-N
SMILES:O(C1=CC(C)=C(Cl)C(C)=C1)C2CCNCC2
Synonyms:
  • 4-(4-Chloro-3,5-dimethylphenoxy)piperidine
  • Piperidine, 4-(4-chloro-3,5-dimethylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.