CymitQuimica logo

CAS 946726-85-8

:

3-(4-Chloro-3,5-dimethylphenoxy)pyrrolidine

Description:
3-(4-Chloro-3,5-dimethylphenoxy)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a phenoxy group substituted with a chlorine atom and two methyl groups. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific functional groups present. The presence of the chloro and methyl substituents can influence its reactivity and interaction with biological systems, potentially making it of interest in pharmaceutical applications. The pyrrolidine moiety may contribute to its ability to act as a ligand or a building block in the synthesis of more complex molecules. Additionally, the compound's molecular weight, boiling point, and melting point would be determined by its specific structure and the interactions between its functional groups. Overall, 3-(4-Chloro-3,5-dimethylphenoxy)pyrrolidine represents a compound with potential utility in various chemical and biological contexts.
Formula:C12H16ClNO
InChI:InChI=1S/C12H16ClNO/c1-8-5-11(6-9(2)12(8)13)15-10-3-4-14-7-10/h5-6,10,14H,3-4,7H2,1-2H3
InChI key:InChIKey=QQYBCDKBKZQOGN-UHFFFAOYSA-N
SMILES:O(C1=CC(C)=C(Cl)C(C)=C1)C2CCNC2
Synonyms:
  • 3-(4-Chloro-3,5-dimethylphenoxy)pyrrolidine
  • Pyrrolidine, 3-(4-chloro-3,5-dimethylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.