
CAS 946726-86-9
:3′-Methoxy[1,1′-biphenyl]-2-methanamine
Description:
3′-Methoxy[1,1′-biphenyl]-2-methanamine, with the CAS number 946726-86-9, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH₃) at the 3′ position and a methanamine group (-CH₂NH₂) at the 2 position contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. Additionally, the methoxy group can enhance lipophilicity, affecting the compound's interaction with biological membranes. The structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature review.
Formula:C14H15NO
InChI:InChI=1S/C14H15NO/c1-16-13-7-4-6-11(9-13)14-8-3-2-5-12(14)10-15/h2-9H,10,15H2,1H3
InChI key:InChIKey=XBKCWOTWIUGAPY-UHFFFAOYSA-N
SMILES:C(N)C1=C(C2=CC(OC)=CC=C2)C=CC=C1
Synonyms:- (3′-Methoxybiphenyl-2-yl)methanamine
- [2-(3-Methoxyphenyl)phenyl]methanamine
- [1,1′-Biphenyl]-2-methanamine, 3′-methoxy-
- 3′-Methoxy[1,1′-biphenyl]-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.