CAS 946726-98-3

4-Fluoro-3′-methyl[1,1′-biphenyl]-3-methanamine

Description:

4-Fluoro-3′-methyl[1,1′-biphenyl]-3-methanamine, with the CAS number 946726-98-3, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 4-position and a methyl group at the 3′-position of the biphenyl framework contributes to its unique chemical properties. Additionally, the compound features a methanamine functional group, which introduces basicity and potential for hydrogen bonding due to the amine (-NH2) group. This compound may exhibit interesting biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can be influenced by the substituents on the biphenyl structure, which can affect its interactions with biological targets. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the fluorine atom, which can impart different toxicological properties compared to non-fluorinated analogs.

Formula: C₁₄H₁₄FN

InChI: InChI=1S/C14H14FN/c1-10-3-2-4-11(7-10)12-5-6-14(15)13(8-12)9-16/h2-8H,9,16H2,1H3

InChI key: InChIKey=UWCAQKMUNIKXNC-UHFFFAOYSA-N

SMILES: C(N)C=1C=C(C=CC1F)C2=CC(C)=CC=C2

Synonyms:

• 4-Fluoro-3′-methyl[1,1′-biphenyl]-3-methanamine
• [1,1′-Biphenyl]-3-methanamine, 4-fluoro-3′-methyl-