CymitQuimica logo

CAS 946727-51-1

:

3-Chloro-2-[3-(1-methylethyl)phenoxy]benzenamine

Description:
3-Chloro-2-[3-(1-methylethyl)phenoxy]benzenamine, with the CAS number 946727-51-1, is an organic compound characterized by its complex aromatic structure. It features a chloro substituent and an amine group, which contribute to its reactivity and potential applications in various chemical processes. The presence of the isopropyl group (1-methylethyl) and the phenoxy moiety enhances its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research or agrochemical applications. Its molecular structure suggests potential for hydrogen bonding due to the amine group, which can affect its physical properties such as melting point and boiling point. Additionally, the chlorine atom can introduce unique electronic effects, potentially impacting the compound's reactivity and stability. Overall, 3-Chloro-2-[3-(1-methylethyl)phenoxy]benzenamine is a compound of interest for further study in both synthetic chemistry and biological applications.
Formula:C15H16ClNO
InChI:InChI=1S/C15H16ClNO/c1-10(2)11-5-3-6-12(9-11)18-15-13(16)7-4-8-14(15)17/h3-10H,17H2,1-2H3
InChI key:InChIKey=PKKAQLGCDFBVIB-UHFFFAOYSA-N
SMILES:O(C1=CC(C(C)C)=CC=C1)C2=C(Cl)C=CC=C2N
Synonyms:
  • 3-Chloro-2-[3-(1-methylethyl)phenoxy]benzenamine
  • Benzenamine, 3-chloro-2-[3-(1-methylethyl)phenoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.