
CAS 946727-72-6
:5-Chloro-2-(2-fluorophenoxy)benzenamine
Description:
5-Chloro-2-(2-fluorophenoxy)benzenamine, with the CAS number 946727-72-6, is an organic compound characterized by its aromatic structure, which includes a chloro substituent and a fluorophenoxy group. This compound features a benzene ring substituted at the 5-position with a chlorine atom and at the 2-position with a phenoxy group that contains a fluorine atom on the phenyl ring. The presence of these halogen substituents can influence the compound's reactivity, solubility, and biological activity. Typically, compounds like this may exhibit properties such as moderate to high lipophilicity due to their aromatic nature, which can affect their interaction with biological systems. Additionally, the presence of both chlorine and fluorine can enhance the compound's stability and may impart specific pharmacological properties, making it of interest in medicinal chemistry and drug development. As with many organic compounds, safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C12H9ClFNO
InChI:InChI=1S/C12H9ClFNO/c13-8-5-6-12(10(15)7-8)16-11-4-2-1-3-9(11)14/h1-7H,15H2
InChI key:InChIKey=QCPJPNRCFCDKJX-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(Cl)C=C1)C2=C(F)C=CC=C2
Synonyms:- 5-Chloro-2-(2-fluorophenoxy)benzenamine
- Benzenamine, 5-chloro-2-(2-fluorophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.