CAS 946727-99-7
:2-(2-Chlorophenoxy)-5-(trifluoromethyl)benzenamine
Description:
2-(2-Chlorophenoxy)-5-(trifluoromethyl)benzenamine, with the CAS number 946727-99-7, is an organic compound characterized by its complex structure, which includes a chlorophenoxy group and a trifluoromethyl group attached to a benzenamine backbone. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's reactivity and biological activity. Additionally, the chlorophenoxy moiety may impart herbicidal or pesticidal properties, making this compound of interest in agricultural chemistry. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety data should be consulted, as compounds with halogenated groups can exhibit toxicity or environmental persistence. Overall, 2-(2-Chlorophenoxy)-5-(trifluoromethyl)benzenamine represents a class of compounds that may have significant utility in various chemical applications.
Formula:C13H9ClF3NO
InChI:InChI=1S/C13H9ClF3NO/c14-9-3-1-2-4-11(9)19-12-6-5-8(7-10(12)18)13(15,16)17/h1-7H,18H2
InChI key:InChIKey=FVOVMZJDWDGYHL-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(C(F)(F)F)C=C1)C2=C(Cl)C=CC=C2
Synonyms:- 2-(2-Chlorophenoxy)-5-(trifluoromethyl)benzenamine
- Benzenamine, 2-(2-chlorophenoxy)-5-(trifluoromethyl)-
- 2-(2-CHLOROPHENOXY)-5-(TRIFLUOROMETHYL)ANILINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.