CAS 946728-47-8

5-Methyl-2-[3-(1-methylethyl)phenoxy]benzenamine

Description:

5-Methyl-2-[3-(1-methylethyl)phenoxy]benzenamine, with the CAS number 946728-47-8, is an organic compound characterized by its complex structure, which includes an amine functional group and multiple aromatic rings. This compound features a methyl group and an isopropyl-substituted phenyl group, contributing to its hydrophobic characteristics. The presence of the phenoxy group enhances its potential for interactions with biological systems, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit specific reactivity patterns typical of amines and phenolic compounds, such as hydrogen bonding and electrophilic substitution. Additionally, its solubility and stability can be influenced by the substituents on the aromatic rings. While specific physical properties like melting point, boiling point, and solubility are not provided, compounds of this nature typically exhibit moderate to low solubility in water but may dissolve well in organic solvents. Understanding its characteristics is crucial for applications in synthesis, formulation, and potential biological activity.

Formula: C₁₆H₁₉NO

InChI: InChI=1S/C16H19NO/c1-11(2)13-5-4-6-14(10-13)18-16-8-7-12(3)9-15(16)17/h4-11H,17H2,1-3H3

InChI key: InChIKey=MDJVYTABSLSMOX-UHFFFAOYSA-N

SMILES: O(C1=C(N)C=C(C)C=C1)C2=CC(C(C)C)=CC=C2

Synonyms:

• Benzenamine, 5-methyl-2-[3-(1-methylethyl)phenoxy]-
• 5-Methyl-2-[3-(1-methylethyl)phenoxy]benzenamine