CymitQuimica logo

CAS 946731-22-2

:

5-Methyl-2-(4-methyl-1-piperazinyl)benzenamine

Description:
5-Methyl-2-(4-methyl-1-piperazinyl)benzenamine, with the CAS number 946731-22-2, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with a methyl group and a piperazine moiety, which contributes to its potential biological activity. The presence of the piperazine ring, a six-membered cyclic amine, often enhances the compound's solubility and interaction with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as being a potential ligand for various receptors or enzymes, and its structural features suggest it could be investigated for pharmacological applications. Additionally, the presence of both the methyl groups and the amine functional group can influence its reactivity and interaction with other chemical species. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the substance. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H19N3
InChI:InChI=1/C12H19N3/c1-10-3-4-12(11(13)9-10)15-7-5-14(2)6-8-15/h3-4,9H,5-8,13H2,1-2H3
InChI key:InChIKey=MDPCCBRUVCKNEY-UHFFFAOYSA-N
SMILES:NC1=C(N2CCN(C)CC2)C=CC(C)=C1
Synonyms:
  • Benzenamine, 5-methyl-2-(4-methyl-1-piperazinyl)-
  • 5-Methyl-2-(4-methyl-1-piperazinyl)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.