CymitQuimica logo

CAS 946742-26-3

:

3-Fluoro-4-[(tetrahydro-2-furanyl)methoxy]benzenamine

Description:
3-Fluoro-4-[(tetrahydro-2-furanyl)methoxy]benzenamine is an organic compound characterized by its aromatic amine structure, which includes a fluorine substituent and a methoxy group linked to a tetrahydro-2-furanyl moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The tetrahydrofuran ring contributes to the compound's overall stability and may affect its solubility and reactivity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its interactions in biological systems. Additionally, the methoxy group can serve as an electron-donating group, potentially modulating the electronic properties of the aromatic ring. Overall, the unique combination of functional groups in 3-Fluoro-4-[(tetrahydro-2-furanyl)methoxy]benzenamine suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C11H14FNO2
InChI:InChI=1S/C11H14FNO2/c12-10-6-8(13)3-4-11(10)15-7-9-2-1-5-14-9/h3-4,6,9H,1-2,5,7,13H2
InChI key:InChIKey=DXZDCWKEIBENSC-UHFFFAOYSA-N
SMILES:O(CC1CCCO1)C2=C(F)C=C(N)C=C2
Synonyms:
  • Benzenamine, 3-fluoro-4-[(tetrahydro-2-furanyl)methoxy]-
  • 3-Fluoro-4-[(tetrahydro-2-furanyl)methoxy]benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.