CymitQuimica logo

CAS 946743-22-2

:

5-Bromo-2-[2-(2-methoxyethoxy)ethoxy]benzenamine

Description:
5-Bromo-2-[2-(2-methoxyethoxy)ethoxy]benzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, an amine group, and multiple ether linkages. The presence of the bromine substituent on the benzene ring enhances its reactivity, making it a useful intermediate in various chemical syntheses. The compound features a triethylene glycol ether moiety, which contributes to its solubility in polar solvents and may influence its biological activity. The methoxyethoxy groups can enhance the compound's hydrophilicity, potentially affecting its pharmacokinetic properties if used in medicinal chemistry. Additionally, the amine functional group can participate in hydrogen bonding, which may play a role in its interactions with biological targets. Overall, this compound's unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and characterization.
Formula:C11H16BrNO3
InChI:InChI=1S/C11H16BrNO3/c1-14-4-5-15-6-7-16-11-3-2-9(12)8-10(11)13/h2-3,8H,4-7,13H2,1H3
InChI key:InChIKey=ABCIHQBDRQTRIP-UHFFFAOYSA-N
SMILES:O(CCOCCOC)C1=C(N)C=C(Br)C=C1
Synonyms:
  • Benzenamine, 5-bromo-2-[2-(2-methoxyethoxy)ethoxy]-
  • 5-Bromo-2-[2-(2-methoxyethoxy)ethoxy]benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.