
CAS 946743-31-3
:5-Bromo-2-[2-(1-piperidinyl)ethoxy]benzenamine
Description:
5-Bromo-2-[2-(1-piperidinyl)ethoxy]benzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, an ethoxy group, and a piperidine moiety. The presence of the bromine substituent on the benzene ring enhances its reactivity and can influence its biological activity. The ethoxy group contributes to the compound's solubility and may affect its interaction with biological targets. The piperidine ring is a six-membered nitrogen-containing heterocycle that is often associated with pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the fields of neuropharmacology or as a scaffold for further chemical modifications. The compound's CAS number, 946743-31-3, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the unique combination of functional groups in 5-Bromo-2-[2-(1-piperidinyl)ethoxy]benzenamine positions it as a potentially valuable compound in various chemical and pharmaceutical applications.
Formula:C13H19BrN2O
InChI:InChI=1S/C13H19BrN2O/c14-11-4-5-13(12(15)10-11)17-9-8-16-6-2-1-3-7-16/h4-5,10H,1-3,6-9,15H2
InChI key:InChIKey=RMPRHRMTDJIEGB-UHFFFAOYSA-N
SMILES:O(CCN1CCCCC1)C2=C(N)C=C(Br)C=C2
Synonyms:- 5-Bromo-2-[2-(1-piperidinyl)ethoxy]benzenamine
- Benzenamine, 5-bromo-2-[2-(1-piperidinyl)ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.