CAS 946744-01-0

N-(3-Pyridinylmethyl)-1H-indole-5-methanamine

Description:

N-(3-Pyridinylmethyl)-1H-indole-5-methanamine, identified by its CAS number 946744-01-0, is a chemical compound that features a complex structure incorporating both indole and pyridine moieties. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its role as a pharmacophore in drug development. The presence of the indole ring contributes to its aromatic properties and potential interactions with biological targets, while the pyridinylmethyl group may enhance solubility and bioavailability. The amine functional group in the structure suggests that it can participate in hydrogen bonding, which is crucial for its interaction with receptors or enzymes. Additionally, the compound may exhibit various physicochemical properties, such as specific melting and boiling points, solubility in different solvents, and stability under various conditions. Its unique combination of functional groups makes it a subject of interest for research in areas such as neuropharmacology and cancer therapy, although specific biological activities would require empirical investigation.

Formula: C₁₅H₁₅N₃

InChI: InChI=1S/C15H15N3/c1-2-13(10-16-6-1)11-17-9-12-3-4-15-14(8-12)5-7-18-15/h1-8,10,17-18H,9,11H2

InChI key: InChIKey=USTRMSVAVRFCNP-UHFFFAOYSA-N

SMILES: C(NCC=1C=CC=NC1)C=2C=C3C(=CC2)NC=C3

Synonyms:

• 1H-Indole-5-methanamine, N-(3-pyridinylmethyl)-
• N-(3-Pyridinylmethyl)-1H-indole-5-methanamine