CAS 946753-31-7
:N-(2-amino-4-methyl-phenyl)cyclopentanecarboxamide
Description:
N-(2-amino-4-methyl-phenyl)cyclopentanecarboxamide, identified by its CAS number 946753-31-7, is a chemical compound characterized by its unique structure, which includes a cyclopentanecarboxamide moiety linked to an aromatic amine. This compound features an amino group and a methyl substituent on the phenyl ring, contributing to its potential biological activity. The presence of the cyclopentane ring adds to its structural complexity, which may influence its solubility and reactivity. Typically, compounds of this nature can exhibit various pharmacological properties, making them of interest in medicinal chemistry. The amide functional group suggests potential for hydrogen bonding, which can affect its interactions with biological targets. Additionally, the specific arrangement of substituents may impart unique steric and electronic properties, influencing its behavior in chemical reactions and biological systems. Overall, N-(2-amino-4-methyl-phenyl)cyclopentanecarboxamide represents a class of compounds that may have applications in drug development and other fields of chemical research.
Formula:C13H18N2O
InChI:InChI=1/C13H18N2O/c1-9-6-7-12(11(14)8-9)15-13(16)10-4-2-3-5-10/h6-8,10H,2-5,14H2,1H3,(H,15,16)
SMILES:Cc1ccc(c(c1)N)N=C(C1CCCC1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
