CymitQuimica logo

CAS 946753-98-6

:

N-(5-amino-2-methylphenyl)-N~2~,N~2~-dimethylglycinamide

Description:
N-(5-amino-2-methylphenyl)-N',N'-dimethylglycinamide, identified by its CAS number 946753-98-6, is a chemical compound characterized by its amine and amide functional groups. This substance features a 2-methylphenyl moiety substituted at the 5-position with an amino group, contributing to its potential biological activity. The presence of dimethylglycinamide indicates that it has two methyl groups attached to the nitrogen of the glycine derivative, which may influence its solubility and reactivity. Typically, compounds of this nature are studied for their pharmacological properties, including potential roles in medicinal chemistry or as intermediates in organic synthesis. The structural characteristics suggest that it may exhibit polar properties, which can affect its interaction with biological systems. Additionally, the compound's stability, reactivity, and potential applications would depend on its specific molecular interactions and the presence of functional groups that can participate in various chemical reactions. Further studies would be necessary to elucidate its full range of properties and applications.
Formula:C11H17N3O
InChI:InChI=1/C11H17N3O/c1-8-4-5-9(12)6-10(8)13-11(15)7-14(2)3/h4-6H,7,12H2,1-3H3,(H,13,15)
SMILES:Cc1ccc(cc1N=C(CN(C)C)O)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.