CAS 946755-45-9

2-(chloromethyl)-6-methyl-1H-quinolin-4-one

Description:

2-(Chloromethyl)-6-methyl-1H-quinolin-4-one is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloromethyl group (-CH2Cl) at the 2-position and a methyl group (-CH3) at the 6-position of the quinoline ring. The presence of these substituents influences its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for various chemical transformations, making it a candidate for further functionalization. Additionally, compounds of this class may possess biological activity, which can be explored in pharmacological studies. Safety data should be consulted for handling, as the chloromethyl group can be reactive and may pose health risks. Overall, 2-(chloromethyl)-6-methyl-1H-quinolin-4-one is of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₁H₁₀ClNO

InChI: InChI=1/C11H10ClNO/c1-7-2-3-10-9(4-7)11(14)5-8(6-12)13-10/h2-5H,6H2,1H3,(H,13,14)

SMILES: Cc1ccc2c(c1)c(=O)cc(CCl)[nH]2

2-(chloromethyl)-6-methyl-4(1H)-quinolinone

CAS: 946755-45-9

Formula: C₁₁H₁₀ClNO

Purity: 95.0%

Molecular weight: 207.66

Ref: 10-F310902