CAS 946755-53-9
:2-(Chloromethyl)-8-fluoro-4(1H)-quinolinone
Description:
2-(Chloromethyl)-8-fluoro-4(1H)-quinolinone is a chemical compound characterized by its quinolinone structure, which features a fused bicyclic system containing a nitrogen atom. This compound includes a chloromethyl group at the 2-position and a fluorine atom at the 8-position of the quinolinone ring, contributing to its unique reactivity and potential biological activity. The presence of the chloromethyl group can facilitate nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The fluorine atom often enhances lipophilicity and can influence the compound's pharmacokinetic properties. This compound may exhibit antimicrobial or anticancer properties, as many quinolinone derivatives are known for their biological activities. Its molecular structure allows for various modifications, which can lead to the development of new derivatives with enhanced efficacy or selectivity in therapeutic applications. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H7ClFNO
InChI:InChI=1S/C10H7ClFNO/c11-5-6-4-9(14)7-2-1-3-8(12)10(7)13-6/h1-4H,5H2,(H,13,14)
InChI key:InChIKey=UCPTYOSWWVWFAC-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(CCl)=C1)=C(F)C=CC2
Synonyms:- 2-(Chloromethyl)-8-fluoro-4(1H)-quinolinone
- 4(1H)-Quinolinone, 2-(chloromethyl)-8-fluoro-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery