CAS 946759-00-8
:3-[(2-Methoxyphenyl)methoxy]piperidine
Description:
3-[(2-Methoxyphenyl)methoxy]piperidine, identified by its CAS number 946759-00-8, is an organic compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a methoxy group attached to a phenyl ring, which is further connected to the piperidine through a methoxy linkage. The presence of the methoxy groups contributes to its solubility in organic solvents and may influence its biological activity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine moiety's role in various biological interactions. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, would be influenced by the substituents on the piperidine and phenyl rings. As with many organic compounds, safety data and handling precautions should be considered, especially in laboratory settings. Overall, 3-[(2-Methoxyphenyl)methoxy]piperidine is of interest for its structural features and potential applications in drug development.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-15-13-7-3-2-5-11(13)10-16-12-6-4-8-14-9-12/h2-3,5,7,12,14H,4,6,8-10H2,1H3
InChI key:InChIKey=SBSYXEBFPMSEJI-UHFFFAOYSA-N
SMILES:C(OC1CCCNC1)C2=C(OC)C=CC=C2
Synonyms:- 3-[(2-Methoxyphenyl)methoxy]piperidine
- Piperidine, 3-[(2-methoxyphenyl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.