CAS 946759-12-2

3-(2-Ethylphenoxy)piperidine

Description:

3-(2-Ethylphenoxy)piperidine is an organic compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The compound features a 2-ethylphenoxy group, indicating that an ethyl-substituted phenyl group is attached via an ether linkage to the piperidine nitrogen. This structure contributes to its potential as a pharmacological agent, as the piperidine ring is often found in various bioactive molecules. The presence of the ethyl group on the phenyl ring can influence the compound's lipophilicity and overall biological activity. 3-(2-Ethylphenoxy)piperidine may exhibit properties such as solubility in organic solvents and varying stability under different conditions. Its specific interactions, such as binding affinity to biological targets, would depend on the compound's three-dimensional conformation and electronic properties. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.

Formula: C₁₃H₁₉NO

InChI: InChI=1S/C13H19NO/c1-2-11-6-3-4-8-13(11)15-12-7-5-9-14-10-12/h3-4,6,8,12,14H,2,5,7,9-10H2,1H3

InChI key: InChIKey=FIJYHGNJVWIUQH-UHFFFAOYSA-N

SMILES: O(C1=C(CC)C=CC=C1)C2CCCNC2

Synonyms:

• 3-(2-Ethylphenoxy)piperidine
• Piperidine, 3-(2-ethylphenoxy)-