CAS 946759-15-5

3-(3-Chloro-4-fluorophenoxy)piperidine

Description:

3-(3-Chloro-4-fluorophenoxy)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. This compound features a phenoxy group, specifically a 3-chloro-4-fluorophenyl moiety, indicating the presence of both chlorine and fluorine substituents on the aromatic ring. The chlorine atom is located at the meta position relative to the ether linkage, while the fluorine is positioned para to the ether bond. This structural arrangement contributes to the compound's unique chemical properties, including its potential for biological activity. The presence of halogens can influence the compound's lipophilicity, reactivity, and interaction with biological targets. 3-(3-Chloro-4-fluorophenoxy)piperidine may be of interest in medicinal chemistry and drug development, particularly in the context of designing compounds with specific pharmacological effects. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions and the presence of other functional groups.

Formula: C₁₁H₁₃ClFNO

InChI: InChI=1S/C11H13ClFNO/c12-10-6-8(3-4-11(10)13)15-9-2-1-5-14-7-9/h3-4,6,9,14H,1-2,5,7H2

InChI key: InChIKey=NPTBCZJXGMWMFA-UHFFFAOYSA-N

SMILES: O(C1=CC(Cl)=C(F)C=C1)C2CCCNC2

Synonyms:

• 3-(3-Chloro-4-fluorophenoxy)piperidine
• Piperidine, 3-(3-chloro-4-fluorophenoxy)-