CAS 946759-28-0

Methanone, (4-chlorophenyl)[4-(3-piperidinyloxy)phenyl]-

Description:

Methanone, (4-chlorophenyl)[4-(3-piperidinyloxy)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a 4-chlorophenyl group introduces a chlorine substituent that can influence the compound's reactivity and biological activity. The second aromatic ring is substituted with a piperidinyloxy group, which adds a nitrogen-containing heterocycle that may enhance the compound's pharmacological properties. This compound is likely to exhibit significant lipophilicity due to its aromatic nature, which can affect its solubility and permeability in biological systems. Additionally, the piperidine moiety may contribute to interactions with biological targets, making it of interest in medicinal chemistry. Overall, the structural features of this compound suggest potential applications in drug development, particularly in areas targeting specific receptors or enzymes. However, detailed studies would be necessary to fully understand its properties, including its stability, reactivity, and biological effects.

Formula: C₁₈H₁₈ClNO₂

InChI: InChI=1S/C18H18ClNO2/c19-15-7-3-13(4-8-15)18(21)14-5-9-16(10-6-14)22-17-2-1-11-20-12-17/h3-10,17,20H,1-2,11-12H2

InChI key: InChIKey=WGTGNCXIULQFAZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC2CCCNC2)C=C1)C3=CC=C(Cl)C=C3

Synonyms:

• Methanone, (4-chlorophenyl)[4-(3-piperidinyloxy)phenyl]-
• (4-Chlorophenyl)-(4-piperidin-3-yloxyphenyl)methanone
• (4-Chlorophenyl)[4-(3-piperidinyloxy)phenyl]-methanone